C13H18N2O3S — CID 97441216
(1S,11S)-14-methyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide (PubChem CID 97441216) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is (1S,11S)-14-methyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide.
| Compound Name | (1S,11S)-14-methyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
|---|---|
| PubChem CID | 97441216 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (1S,11S)-14-methyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
| SMILES | CN1CC[C@@H]2NS(=O)(=O)c3ccccc3O[C@H]2CC1 |
| InChI | InChI=1S/C13H18N2O3S/c1-15-8-6-10-11(7-9-15)18-12-4-2-3-5-13(12)19(16,17)14-10/h2-5,10-11,14H,6-9H2,1H3/t10-,11-/m0/s1 |
| InChIKey | YRXWFDHCJVQBCI-QWRGUYRKSA-N |
| XLogP | 0.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |