C23H26FN3O — CID 97441664
N-[2-(3-fluorophenyl)ethyl]-3-(4-methylpiperidin-1-yl)indolizine-6-carboxamide (PubChem CID 97441664) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-3-(4-methylpiperidin-1-yl)indolizine-6-carboxamide.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-3-(4-methylpiperidin-1-yl)indolizine-6-carboxamide |
|---|---|
| PubChem CID | 97441664 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-3-(4-methylpiperidin-1-yl)indolizine-6-carboxamide |
| SMILES | CC1CCN(c2ccc3ccc(C(=O)NCCc4cccc(F)c4)cn23)CC1 |
| InChI | InChI=1S/C23H26FN3O/c1-17-10-13-26(14-11-17)22-8-7-21-6-5-19(16-27(21)22)23(28)25-12-9-18-3-2-4-20(24)15-18/h2-8,15-17H,9-14H2,1H3,(H,25,28) |
| InChIKey | YSOXZQDRDWWSDW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |