C20H26N4O2S — CID 97442505
6-N-benzyl-2-N-(2-methylpropyl)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxamide (PubChem CID 97442505) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 6-N-benzyl-2-N-(2-methylpropyl)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxamide.
| Compound Name | 6-N-benzyl-2-N-(2-methylpropyl)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 97442505 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 6-N-benzyl-2-N-(2-methylpropyl)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxamide |
| SMILES | CC(C)CNC(=O)c1nc2c(s1)CCN(C(=O)NCc1ccccc1)CC2 |
| InChI | InChI=1S/C20H26N4O2S/c1-14(2)12-21-18(25)19-23-16-8-10-24(11-9-17(16)27-19)20(26)22-13-15-6-4-3-5-7-15/h3-7,14H,8-13H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | XCBYPSRRZMJDKC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |