C22H26N6O2 — CID 97443109
4-(2-anilinopyrimidin-5-yl)-1-methyl-N-(2-morpholin-4-ylethyl)pyrrole-2-carboxamide (PubChem CID 97443109) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-(2-anilinopyrimidin-5-yl)-1-methyl-N-(2-morpholin-4-ylethyl)pyrrole-2-carboxamide.
| Compound Name | 4-(2-anilinopyrimidin-5-yl)-1-methyl-N-(2-morpholin-4-ylethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97443109 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-(2-anilinopyrimidin-5-yl)-1-methyl-N-(2-morpholin-4-ylethyl)pyrrole-2-carboxamide |
| SMILES | Cn1cc(-c2cnc(Nc3ccccc3)nc2)cc1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C22H26N6O2/c1-27-16-17(13-20(27)21(29)23-7-8-28-9-11-30-12-10-28)18-14-24-22(25-15-18)26-19-5-3-2-4-6-19/h2-6,13-16H,7-12H2,1H3,(H,23,29)(H,24,25,26) |
| InChIKey | BVNURJPYFDDQHN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |