C19H24N4O — CID 97444484
(2R)-N-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-ethyl-2,5-dihydropyrrole-1-carboxamide (PubChem CID 97444484) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is (2R)-N-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-ethyl-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | (2R)-N-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-ethyl-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 97444484 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (2R)-N-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-ethyl-2,5-dihydropyrrole-1-carboxamide |
| SMILES | CC[C@@H]1C=CCN1C(=O)Nc1ccc(Cn2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H24N4O/c1-4-18-6-5-11-22(18)19(24)20-17-9-7-16(8-10-17)13-23-15(3)12-14(2)21-23/h5-10,12,18H,4,11,13H2,1-3H3,(H,20,24)/t18-/m1/s1 |
| InChIKey | GJUXLRKREZUEPF-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|