C15H16ClN7O — CID 97444504
(3-chloro-6-methylpyrazolo[1,5-a]pyrimidin-2-yl)-[(5R)-3,5-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 97444504) has the molecular formula C15H16ClN7O and a molecular weight of 345.79 g/mol. Its IUPAC name is (3-chloro-6-methylpyrazolo[1,5-a]pyrimidin-2-yl)-[(5R)-3,5-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (3-chloro-6-methylpyrazolo[1,5-a]pyrimidin-2-yl)-[(5R)-3,5-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 97444504 |
| Molecular Formula | C15H16ClN7O |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (3-chloro-6-methylpyrazolo[1,5-a]pyrimidin-2-yl)-[(5R)-3,5-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | Cc1cnc2c(Cl)c(C(=O)N3Cc4nnc(C)n4[C@H](C)C3)nn2c1 |
| InChI | InChI=1S/C15H16ClN7O/c1-8-4-17-14-12(16)13(20-22(14)5-8)15(24)21-6-9(2)23-10(3)18-19-11(23)7-21/h4-5,9H,6-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | NGTZMWPAVZPAKG-SECBINFHSA-N |
| XLogP | 1.81 |
| TPSA | 81.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |