C14H11ClN6OS — CID 974456
N-(5-chloro-2-pyridinyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 974456) has the molecular formula C14H11ClN6OS and a molecular weight of 346.80 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 974456 |
| Molecular Formula | C14H11ClN6OS |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H11ClN6OS/c15-10-6-7-12(16-8-10)17-13(22)9-23-14-18-19-20-21(14)11-4-2-1-3-5-11/h1-8H,9H2,(H,16,17,22) |
| InChIKey | WLBDNDIDOYLXSE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |