C20H16FN3O3S — CID 97446668
2-[6-(4-fluorophenyl)-1,2-benzoxazol-3-yl]-N-(2-methoxyethyl)-1,3-thiazole-5-carboxamide (PubChem CID 97446668) has the molecular formula C20H16FN3O3S and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[6-(4-fluorophenyl)-1,2-benzoxazol-3-yl]-N-(2-methoxyethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[6-(4-fluorophenyl)-1,2-benzoxazol-3-yl]-N-(2-methoxyethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 97446668 |
| Molecular Formula | C20H16FN3O3S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-[6-(4-fluorophenyl)-1,2-benzoxazol-3-yl]-N-(2-methoxyethyl)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNC(=O)c1cnc(-c2noc3cc(-c4ccc(F)cc4)ccc23)s1 |
| InChI | InChI=1S/C20H16FN3O3S/c1-26-9-8-22-19(25)17-11-23-20(28-17)18-15-7-4-13(10-16(15)27-24-18)12-2-5-14(21)6-3-12/h2-7,10-11H,8-9H2,1H3,(H,22,25) |
| InChIKey | YTLIFDJNBWEYQD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|