C15H17ClN2O2 — CID 97449189
(5R)-2-[(2-chlorophenyl)methyl]-2,9-diazaspiro[4.5]decane-1,3-dione (PubChem CID 97449189) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is (5R)-2-[(2-chlorophenyl)methyl]-2,9-diazaspiro[4.5]decane-1,3-dione.
| Compound Name | (5R)-2-[(2-chlorophenyl)methyl]-2,9-diazaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 97449189 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (5R)-2-[(2-chlorophenyl)methyl]-2,9-diazaspiro[4.5]decane-1,3-dione |
| SMILES | O=C1C[C@@]2(CCCNC2)C(=O)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C15H17ClN2O2/c16-12-5-2-1-4-11(12)9-18-13(19)8-15(14(18)20)6-3-7-17-10-15/h1-2,4-5,17H,3,6-10H2/t15-/m1/s1 |
| InChIKey | DBYVOQDPXWHDNA-OAHLLOKOSA-N |
| XLogP | 1.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|