About N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide
N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide (PubChem CID 97449355) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide |
| PubChem CID | 97449355 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide |
| SMILES | CN(C)C(=O)N1CCC2(CC1)NC(=O)c1ccccc12 |
| InChI | InChI=1S/C15H19N3O2/c1-17(2)14(20)18-9-7-15(8-10-18)12-6-4-3-5-11(12)13(19)16-15/h3-6H,7-10H2,1-2H3,(H,16,19) |
| InChIKey | MIUIERVBVIMDJP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide?
The IUPAC name of N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide (CID 97449355) is N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide.
What is the SMILES notation for N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide?
The canonical SMILES for N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide is CN(C)C(=O)N1CCC2(CC1)NC(=O)c1ccccc12.
What is the InChIKey of N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide?
The InChIKey is MIUIERVBVIMDJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-17(2)14(20)18-9-7-15(8-10-18)12-6-4-3-5-11(12)13(19)16-15/h3-6H,7-10H2,1-2H3,(H,16,19).
What are the key properties of N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide?
N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide has a molecular weight of 273.34 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-oxospiro[2H-isoindole-1,4'-piperidine]-1'-carboxamide is sourced from PubChem (CID 97449355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).