C18H23FN4O — CID 97450304
cyclopent-3-en-1-yl-[(5R)-9-(5-fluoropyrimidin-2-yl)-2,9-diazaspiro[4.5]decan-2-yl]methanone (PubChem CID 97450304) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[(5R)-9-(5-fluoropyrimidin-2-yl)-2,9-diazaspiro[4.5]decan-2-yl]methanone.
| Compound Name | cyclopent-3-en-1-yl-[(5R)-9-(5-fluoropyrimidin-2-yl)-2,9-diazaspiro[4.5]decan-2-yl]methanone |
|---|---|
| PubChem CID | 97450304 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | cyclopent-3-en-1-yl-[(5R)-9-(5-fluoropyrimidin-2-yl)-2,9-diazaspiro[4.5]decan-2-yl]methanone |
| SMILES | O=C(C1CC=CC1)N1CC[C@@]2(CCCN(c3ncc(F)cn3)C2)C1 |
| InChI | InChI=1S/C18H23FN4O/c19-15-10-20-17(21-11-15)23-8-3-6-18(13-23)7-9-22(12-18)16(24)14-4-1-2-5-14/h1-2,10-11,14H,3-9,12-13H2/t18-/m0/s1 |
| InChIKey | QVGYMZBJIHOOIG-SFHVURJKSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|