About 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone
1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone (PubChem CID 97452553) has the molecular formula C18H23FN2O
and a molecular weight of 302.39 g/mol. Its IUPAC name is 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone.
Molecular Properties
| Compound Name | 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone |
| PubChem CID | 97452553 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CC1)CN(CC1CC1)c1ccc(F)cc12 |
| InChI | InChI=1S/C18H23FN2O/c1-13(22)20-8-6-18(7-9-20)12-21(11-14-2-3-14)17-5-4-15(19)10-16(17)18/h4-5,10,14H,2-3,6-9,11-12H2,1H3 |
| InChIKey | PYNBLBQFOQRUHV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone?
The IUPAC name of 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone (CID 97452553) is 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone.
What is the SMILES notation for 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone?
The canonical SMILES for 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone is CC(=O)N1CCC2(CC1)CN(CC1CC1)c1ccc(F)cc12.
What is the InChIKey of 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone?
The InChIKey is PYNBLBQFOQRUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FN2O/c1-13(22)20-8-6-18(7-9-20)12-21(11-14-2-3-14)17-5-4-15(19)10-16(17)18/h4-5,10,14H,2-3,6-9,11-12H2,1H3.
What are the key properties of 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone?
1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone has a molecular weight of 302.39 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]ethanone is sourced from PubChem (CID 97452553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).