About 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone
1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone (PubChem CID 97452554) has the molecular formula C19H25FN2O2
and a molecular weight of 332.42 g/mol. Its IUPAC name is 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone.
Molecular Properties
| Compound Name | 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone |
| PubChem CID | 97452554 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC2(CC1)CN(CC1CC1)c1ccc(F)cc12 |
| InChI | InChI=1S/C19H25FN2O2/c1-24-12-18(23)21-8-6-19(7-9-21)13-22(11-14-2-3-14)17-5-4-15(20)10-16(17)19/h4-5,10,14H,2-3,6-9,11-13H2,1H3 |
| InChIKey | POINOHJPHWWKPK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone?
The IUPAC name of 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone (CID 97452554) is 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone.
What is the SMILES notation for 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone?
The canonical SMILES for 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone is COCC(=O)N1CCC2(CC1)CN(CC1CC1)c1ccc(F)cc12.
What is the InChIKey of 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone?
The InChIKey is POINOHJPHWWKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25FN2O2/c1-24-12-18(23)21-8-6-19(7-9-21)13-22(11-14-2-3-14)17-5-4-15(20)10-16(17)19/h4-5,10,14H,2-3,6-9,11-13H2,1H3.
What are the key properties of 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone?
1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone has a molecular weight of 332.42 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(cyclopropylmethyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2-methoxyethanone is sourced from PubChem (CID 97452554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).