About cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone
cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone (PubChem CID 97452558) has the molecular formula C19H25FN2O2
and a molecular weight of 332.42 g/mol. Its IUPAC name is cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
| PubChem CID | 97452558 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
| SMILES | COCCN1CCC2(CC1)CN(C(=O)C1CC1)c1ccc(F)cc12 |
| InChI | InChI=1S/C19H25FN2O2/c1-24-11-10-21-8-6-19(7-9-21)13-22(18(23)14-2-3-14)17-5-4-15(20)12-16(17)19/h4-5,12,14H,2-3,6-11,13H2,1H3 |
| InChIKey | YKMGBTFFYZVLPY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone?
The IUPAC name of cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone (CID 97452558) is cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone.
What is the SMILES notation for cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone?
The canonical SMILES for cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone is COCCN1CCC2(CC1)CN(C(=O)C1CC1)c1ccc(F)cc12.
What is the InChIKey of cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone?
The InChIKey is YKMGBTFFYZVLPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25FN2O2/c1-24-11-10-21-8-6-19(7-9-21)13-22(18(23)14-2-3-14)17-5-4-15(20)12-16(17)19/h4-5,12,14H,2-3,6-11,13H2,1H3.
What are the key properties of cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone?
cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone has a molecular weight of 332.42 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[5-fluoro-1'-(2-methoxyethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone is sourced from PubChem (CID 97452558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).