C16H23N5S — CID 97452917
4-[[(3aR,6aS)-5-[(1-methylimidazol-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 97452917) has the molecular formula C16H23N5S and a molecular weight of 317.46 g/mol. Its IUPAC name is 4-[[(3aR,6aS)-5-[(1-methylimidazol-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[(3aR,6aS)-5-[(1-methylimidazol-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 97452917 |
| Molecular Formula | C16H23N5S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-[[(3aR,6aS)-5-[(1-methylimidazol-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(CN2C[C@@H]3CN(Cc4nccn4C)C[C@@H]3C2)cs1 |
| InChI | InChI=1S/C16H23N5S/c1-12-18-15(11-22-12)9-20-5-13-7-21(8-14(13)6-20)10-16-17-3-4-19(16)2/h3-4,11,13-14H,5-10H2,1-2H3/t13-,14+ |
| InChIKey | VFIODDYZTYNYTI-OKILXGFUSA-N |
| XLogP | 1.75 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |