C16H18FN5 — CID 97452966
(3aR,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(pyridin-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 97452966) has the molecular formula C16H18FN5 and a molecular weight of 299.35 g/mol. Its IUPAC name is (3aR,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(pyridin-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(pyridin-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 97452966 |
| Molecular Formula | C16H18FN5 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (3aR,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(pyridin-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Fc1cnc(N2C[C@H]3CN(Cc4ccccn4)C[C@H]3C2)nc1 |
| InChI | InChI=1S/C16H18FN5/c17-14-5-19-16(20-6-14)22-9-12-7-21(8-13(12)10-22)11-15-3-1-2-4-18-15/h1-6,12-13H,7-11H2/t12-,13+ |
| InChIKey | UOPJXRQVGOPWQL-BETUJISGSA-N |
| XLogP | 1.58 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |