C15H19N5S — CID 97453020
2-[[(3aR,6aS)-5-(5-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole (PubChem CID 97453020) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-[[(3aR,6aS)-5-(5-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(3aR,6aS)-5-(5-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97453020 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[[(3aR,6aS)-5-(5-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole |
| SMILES | Cc1cnc(N2C[C@H]3CN(Cc4nccs4)C[C@H]3C2)nc1 |
| InChI | InChI=1S/C15H19N5S/c1-11-4-17-15(18-5-11)20-8-12-6-19(7-13(12)9-20)10-14-16-2-3-21-14/h2-5,12-13H,6-10H2,1H3/t12-,13+ |
| InChIKey | IJJBHIHMLFSLJX-BETUJISGSA-N |
| XLogP | 1.81 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |