C14H16N4OS2 — CID 97453025
[(3aS,6aR)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 97453025) has the molecular formula C14H16N4OS2 and a molecular weight of 320.44 g/mol. Its IUPAC name is [(3aS,6aR)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(3aS,6aR)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97453025 |
| Molecular Formula | C14H16N4OS2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [(3aS,6aR)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1C[C@H]2CN(Cc3nccs3)C[C@H]2C1 |
| InChI | InChI=1S/C14H16N4OS2/c19-14(12-8-20-9-16-12)18-5-10-3-17(4-11(10)6-18)7-13-15-1-2-21-13/h1-2,8-11H,3-7H2/t10-,11+ |
| InChIKey | LZRLBDBADWQVFN-PHIMTYICSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |