C15H21N3O2S — CID 97453038
[(3aR,6aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 97453038) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is [(3aR,6aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [(3aR,6aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 97453038 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [(3aR,6aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCO1)N1C[C@H]2CN(Cc3nccs3)C[C@H]2C1 |
| InChI | InChI=1S/C15H21N3O2S/c19-15(13-2-1-4-20-13)18-8-11-6-17(7-12(11)9-18)10-14-16-3-5-21-14/h3,5,11-13H,1-2,4,6-10H2/t11-,12+,13-/m0/s1 |
| InChIKey | OHTSQTLQQJNWBN-XQQFMLRXSA-N |
| XLogP | 1.21 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |