C17H19FN4 — CID 97453042
(3aR,6aS)-2-[(3-fluorophenyl)methyl]-5-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 97453042) has the molecular formula C17H19FN4 and a molecular weight of 298.36 g/mol. Its IUPAC name is (3aR,6aS)-2-[(3-fluorophenyl)methyl]-5-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-2-[(3-fluorophenyl)methyl]-5-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 97453042 |
| Molecular Formula | C17H19FN4 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3aR,6aS)-2-[(3-fluorophenyl)methyl]-5-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Fc1cccc(CN2C[C@@H]3CN(c4ncccn4)C[C@@H]3C2)c1 |
| InChI | InChI=1S/C17H19FN4/c18-16-4-1-3-13(7-16)8-21-9-14-11-22(12-15(14)10-21)17-19-5-2-6-20-17/h1-7,14-15H,8-12H2/t14-,15+ |
| InChIKey | ALEBMQQYHNWJTG-GASCZTMLSA-N |
| XLogP | 2.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |