C18H19FN4O — CID 97453052
[(3aR,6aS)-2-[(3-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridazin-4-ylmethanone (PubChem CID 97453052) has the molecular formula C18H19FN4O and a molecular weight of 326.37 g/mol. Its IUPAC name is [(3aR,6aS)-2-[(3-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(3aR,6aS)-2-[(3-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 97453052 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [(3aR,6aS)-2-[(3-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridazin-4-ylmethanone |
| SMILES | O=C(c1ccnnc1)N1C[C@H]2CN(Cc3cccc(F)c3)C[C@H]2C1 |
| InChI | InChI=1S/C18H19FN4O/c19-17-3-1-2-13(6-17)8-22-9-15-11-23(12-16(15)10-22)18(24)14-4-5-20-21-7-14/h1-7,15-16H,8-12H2/t15-,16+ |
| InChIKey | PMDYFLUXPWAMPI-IYBDPMFKSA-N |
| XLogP | 1.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |