C20H24N4O3 — CID 97453287
1-[[(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl]-1-methyl-3-(4-pyridin-3-yloxyphenyl)urea (PubChem CID 97453287) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-[[(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl]-1-methyl-3-(4-pyridin-3-yloxyphenyl)urea.
| Compound Name | 1-[[(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl]-1-methyl-3-(4-pyridin-3-yloxyphenyl)urea |
|---|---|
| PubChem CID | 97453287 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[[(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl]-1-methyl-3-(4-pyridin-3-yloxyphenyl)urea |
| SMILES | CCN1C[C@H](CN(C)C(=O)Nc2ccc(Oc3cccnc3)cc2)CC1=O |
| InChI | InChI=1S/C20H24N4O3/c1-3-24-14-15(11-19(24)25)13-23(2)20(26)22-16-6-8-17(9-7-16)27-18-5-4-10-21-12-18/h4-10,12,15H,3,11,13-14H2,1-2H3,(H,22,26)/t15-/m0/s1 |
| InChIKey | AFLLOTQFIIYECG-HNNXBMFYSA-N |
| XLogP | 3.21 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |