C15H20N4O4 — CID 97454633
2-methyl-5-[(2R)-2-(morpholine-4-carbonyl)pyrrolidine-1-carbonyl]-1H-pyrimidin-6-one (PubChem CID 97454633) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-methyl-5-[(2R)-2-(morpholine-4-carbonyl)pyrrolidine-1-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-5-[(2R)-2-(morpholine-4-carbonyl)pyrrolidine-1-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 97454633 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-methyl-5-[(2R)-2-(morpholine-4-carbonyl)pyrrolidine-1-carbonyl]-1H-pyrimidin-6-one |
| SMILES | Cc1ncc(C(=O)N2CCC[C@@H]2C(=O)N2CCOCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H20N4O4/c1-10-16-9-11(13(20)17-10)14(21)19-4-2-3-12(19)15(22)18-5-7-23-8-6-18/h9,12H,2-8H2,1H3,(H,16,17,20)/t12-/m1/s1 |
| InChIKey | HNGWUUAQQLOXNR-GFCCVEGCSA-N |
| XLogP | -0.46 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |