About 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea
1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea (PubChem CID 97455064) has the molecular formula C14H17F3N2O4S
and a molecular weight of 366.36 g/mol. Its IUPAC name is 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea.
Molecular Properties
| Compound Name | 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea |
| PubChem CID | 97455064 |
| Molecular Formula | C14H17F3N2O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea |
| SMILES | COc1cc(NC(=O)N[C@]2(C)CCS(=O)(=O)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O4S/c1-13(3-4-24(21,22)8-13)19-12(20)18-10-5-9(14(15,16)17)6-11(7-10)23-2/h5-7H,3-4,8H2,1-2H3,(H2,18,19,20)/t13-/m1/s1 |
| InChIKey | OMCDTPBCRPVTBG-CYBMUJFWSA-N |
| XLogP | 2.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea?
The IUPAC name of 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea (CID 97455064) is 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea.
What is the SMILES notation for 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea?
The canonical SMILES for 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea is COc1cc(NC(=O)N[C@]2(C)CCS(=O)(=O)C2)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea?
The InChIKey is OMCDTPBCRPVTBG-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H17F3N2O4S/c1-13(3-4-24(21,22)8-13)19-12(20)18-10-5-9(14(15,16)17)6-11(7-10)23-2/h5-7H,3-4,8H2,1-2H3,(H2,18,19,20)/t13-/m1/s1.
What are the key properties of 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea?
1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea has a molecular weight of 366.36 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-methoxy-5-(trifluoromethyl)phenyl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]urea is sourced from PubChem (CID 97455064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).