C14H25N3O2 — CID 97455138
(E)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methylpent-2-enamide (PubChem CID 97455138) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is (E)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methylpent-2-enamide.
| Compound Name | (E)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 97455138 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | (E)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methylpent-2-enamide |
| SMILES | CC/C=C(\C)C(=O)NCCN1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C14H25N3O2/c1-4-5-12(2)14(19)15-6-7-16-8-10-17(11-9-16)13(3)18/h5H,4,6-11H2,1-3H3,(H,15,19)/b12-5+ |
| InChIKey | XMJXNRSASYJAJS-LFYBBSHMSA-N |
| XLogP | 0.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|