C13H12N2O5 — CID 97455871
2-[(R)-carboxy-(4-methoxyphenyl)methyl]pyrazole-3-carboxylic acid (PubChem CID 97455871) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-[(R)-carboxy-(4-methoxyphenyl)methyl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[(R)-carboxy-(4-methoxyphenyl)methyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 97455871 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[(R)-carboxy-(4-methoxyphenyl)methyl]pyrazole-3-carboxylic acid |
| SMILES | COc1ccc([C@H](C(=O)O)n2nccc2C(=O)O)cc1 |
| InChI | InChI=1S/C13H12N2O5/c1-20-9-4-2-8(3-5-9)11(13(18)19)15-10(12(16)17)6-7-14-15/h2-7,11H,1H3,(H,16,17)(H,18,19)/t11-/m1/s1 |
| InChIKey | YURLUOCPRDGMNA-LLVKDONJSA-N |
| XLogP | 1.26 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |