About (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide
(2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide (PubChem CID 97457326) has the molecular formula C17H24N2O3
and a molecular weight of 304.39 g/mol. Its IUPAC name is (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide.
Molecular Properties
| Compound Name | (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide |
| PubChem CID | 97457326 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1OCC(=O)N(C)[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-5-19(6-2)17(21)16-15(18(4)14(20)11-22-16)13-9-7-12(3)8-10-13/h7-10,15-16H,5-6,11H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | DUKNWDOTDRWZIR-HZPDHXFCSA-N |
| XLogP | 1.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide?
The IUPAC name of (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide (CID 97457326) is (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide.
What is the SMILES notation for (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide?
The canonical SMILES for (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide is CCN(CC)C(=O)[C@@H]1OCC(=O)N(C)[C@@H]1c1ccc(C)cc1.
What is the InChIKey of (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide?
The InChIKey is DUKNWDOTDRWZIR-HZPDHXFCSA-N. The full InChI is InChI=1S/C17H24N2O3/c1-5-19(6-2)17(21)16-15(18(4)14(20)11-22-16)13-9-7-12(3)8-10-13/h7-10,15-16H,5-6,11H2,1-4H3/t15-,16-/m1/s1.
What are the key properties of (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide?
(2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide has a molecular weight of 304.39 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-N,N-diethyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide is sourced from PubChem (CID 97457326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).