C17H19N5O2 — CID 97457864
[(3aR,6aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridin-3-ylmethanone (PubChem CID 97457864) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is [(3aR,6aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3aR,6aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 97457864 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | [(3aR,6aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridin-3-ylmethanone |
| SMILES | COc1cc(N2C[C@H]3CN(C(=O)c4cccnc4)C[C@H]3C2)ncn1 |
| InChI | InChI=1S/C17H19N5O2/c1-24-16-5-15(19-11-20-16)21-7-13-9-22(10-14(13)8-21)17(23)12-3-2-4-18-6-12/h2-6,11,13-14H,7-10H2,1H3/t13-,14+ |
| InChIKey | YOPABBIRTJOPCO-OKILXGFUSA-N |
| XLogP | 1.09 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |