C16H23N3O3S — CID 97458013
(2R,3aR,6aR)-N,1-dimethyl-5-(4-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide (PubChem CID 97458013) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is (2R,3aR,6aR)-N,1-dimethyl-5-(4-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide.
| Compound Name | (2R,3aR,6aR)-N,1-dimethyl-5-(4-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97458013 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (2R,3aR,6aR)-N,1-dimethyl-5-(4-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]2N1C |
| InChI | InChI=1S/C16H23N3O3S/c1-11-4-6-13(7-5-11)23(21,22)19-9-12-8-14(16(20)17-2)18(3)15(12)10-19/h4-7,12,14-15H,8-10H2,1-3H3,(H,17,20)/t12-,14-,15+/m1/s1 |
| InChIKey | UDFPLFMEYNZMNP-YUELXQCFSA-N |
| XLogP | 0.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |