C16H22FN3O3S — CID 97458017
(2R,3aR,6aR)-5-(3-fluoro-4-methylphenyl)sulfonyl-N,1-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide (PubChem CID 97458017) has the molecular formula C16H22FN3O3S and a molecular weight of 355.44 g/mol. Its IUPAC name is (2R,3aR,6aR)-5-(3-fluoro-4-methylphenyl)sulfonyl-N,1-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide.
| Compound Name | (2R,3aR,6aR)-5-(3-fluoro-4-methylphenyl)sulfonyl-N,1-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97458017 |
| Molecular Formula | C16H22FN3O3S |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (2R,3aR,6aR)-5-(3-fluoro-4-methylphenyl)sulfonyl-N,1-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@@H]2CN(S(=O)(=O)c3ccc(C)c(F)c3)C[C@@H]2N1C |
| InChI | InChI=1S/C16H22FN3O3S/c1-10-4-5-12(7-13(10)17)24(22,23)20-8-11-6-14(16(21)18-2)19(3)15(11)9-20/h4-5,7,11,14-15H,6,8-9H2,1-3H3,(H,18,21)/t11-,14-,15+/m1/s1 |
| InChIKey | ICJKVPGACACTCW-DFBGVHRSSA-N |
| XLogP | 0.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |