C17H25FN6O — CID 97458028
[(2R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 97458028) has the molecular formula C17H25FN6O and a molecular weight of 348.43 g/mol. Its IUPAC name is [(2R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(2R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 97458028 |
| Molecular Formula | C17H25FN6O |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [(2R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)[C@H]2C[C@@H]3CN(c4ncc(F)cn4)C[C@@H]3N2C)CC1 |
| InChI | InChI=1S/C17H25FN6O/c1-21-3-5-23(6-4-21)16(25)14-7-12-10-24(11-15(12)22(14)2)17-19-8-13(18)9-20-17/h8-9,12,14-15H,3-7,10-11H2,1-2H3/t12-,14-,15+/m1/s1 |
| InChIKey | MHDTXBUWAIBKOW-YUELXQCFSA-N |
| XLogP | -0.10 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |