C16H21N3O4S — CID 97458101
(2R,3aR,6aR)-1-acetyl-5-(benzenesulfonyl)-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide (PubChem CID 97458101) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-acetyl-5-(benzenesulfonyl)-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide.
| Compound Name | (2R,3aR,6aR)-1-acetyl-5-(benzenesulfonyl)-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97458101 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (2R,3aR,6aR)-1-acetyl-5-(benzenesulfonyl)-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@@H]2CN(S(=O)(=O)c3ccccc3)C[C@@H]2N1C(C)=O |
| InChI | InChI=1S/C16H21N3O4S/c1-11(20)19-14(16(21)17-2)8-12-9-18(10-15(12)19)24(22,23)13-6-4-3-5-7-13/h3-7,12,14-15H,8-10H2,1-2H3,(H,17,21)/t12-,14-,15+/m1/s1 |
| InChIKey | DSAGJJPNKNANEL-YUELXQCFSA-N |
| XLogP | 0.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |