C15H24N4O3 — CID 97458308
(7R,8aS)-7-(2-methoxyethoxy)-2-(6-methoxypyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 97458308) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (7R,8aS)-7-(2-methoxyethoxy)-2-(6-methoxypyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-7-(2-methoxyethoxy)-2-(6-methoxypyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 97458308 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (7R,8aS)-7-(2-methoxyethoxy)-2-(6-methoxypyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COCCO[C@@H]1C[C@H]2CN(c3cc(OC)ncn3)CCN2C1 |
| InChI | InChI=1S/C15H24N4O3/c1-20-5-6-22-13-7-12-9-19(4-3-18(12)10-13)14-8-15(21-2)17-11-16-14/h8,11-13H,3-7,9-10H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | GTTUPOBJRGVXIM-QWHCGFSZSA-N |
| XLogP | 0.41 |
| TPSA | 59.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|