C15H22N4O3 — CID 97458316
[(7R,8aS)-7-(2-methoxyethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyrazin-2-ylmethanone (PubChem CID 97458316) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is [(7R,8aS)-7-(2-methoxyethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(7R,8aS)-7-(2-methoxyethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 97458316 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [(7R,8aS)-7-(2-methoxyethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyrazin-2-ylmethanone |
| SMILES | COCCO[C@@H]1C[C@H]2CN(C(=O)c3cnccn3)CCN2C1 |
| InChI | InChI=1S/C15H22N4O3/c1-21-6-7-22-13-8-12-10-19(5-4-18(12)11-13)15(20)14-9-16-2-3-17-14/h2-3,9,12-13H,4-8,10-11H2,1H3/t12-,13+/m0/s1 |
| InChIKey | PSLPNSWBCGDBJI-QWHCGFSZSA-N |
| XLogP | 0.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|