C18H21N3O2S — CID 97458442
[(7R,8aS)-7-(pyridin-2-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-thiophen-3-ylmethanone (PubChem CID 97458442) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is [(7R,8aS)-7-(pyridin-2-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-thiophen-3-ylmethanone.
| Compound Name | [(7R,8aS)-7-(pyridin-2-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 97458442 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(7R,8aS)-7-(pyridin-2-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCN2C[C@H](OCc3ccccn3)C[C@H]2C1 |
| InChI | InChI=1S/C18H21N3O2S/c22-18(14-4-8-24-13-14)21-7-6-20-11-17(9-16(20)10-21)23-12-15-3-1-2-5-19-15/h1-5,8,13,16-17H,6-7,9-12H2/t16-,17+/m0/s1 |
| InChIKey | LVMFXHZLVFWRIG-DLBZAZTESA-N |
| XLogP | 2.26 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |