C19H22FN3O — CID 97458466
(7R,8aS)-7-(3-fluorophenoxy)-2-(pyridin-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 97458466) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is (7R,8aS)-7-(3-fluorophenoxy)-2-(pyridin-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-7-(3-fluorophenoxy)-2-(pyridin-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 97458466 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (7R,8aS)-7-(3-fluorophenoxy)-2-(pyridin-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Fc1cccc(O[C@@H]2C[C@H]3CN(Cc4ccccn4)CCN3C2)c1 |
| InChI | InChI=1S/C19H22FN3O/c20-15-4-3-6-18(10-15)24-19-11-17-13-22(8-9-23(17)14-19)12-16-5-1-2-7-21-16/h1-7,10,17,19H,8-9,11-14H2/t17-,19+/m0/s1 |
| InChIKey | DSUWTUWTDJPZJT-PKOBYXMFSA-N |
| XLogP | 2.56 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |