C18H21FN4O — CID 97458482
(7R,8aS)-7-[(2-fluorophenyl)methoxy]-2-pyrimidin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 97458482) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is (7R,8aS)-7-[(2-fluorophenyl)methoxy]-2-pyrimidin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-7-[(2-fluorophenyl)methoxy]-2-pyrimidin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 97458482 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (7R,8aS)-7-[(2-fluorophenyl)methoxy]-2-pyrimidin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Fc1ccccc1CO[C@@H]1C[C@H]2CN(c3ncccn3)CCN2C1 |
| InChI | InChI=1S/C18H21FN4O/c19-17-5-2-1-4-14(17)13-24-16-10-15-11-23(9-8-22(15)12-16)18-20-6-3-7-21-18/h1-7,15-16H,8-13H2/t15-,16+/m0/s1 |
| InChIKey | OIUFFOQGOSDJHD-JKSUJKDBSA-N |
| XLogP | 2.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |