C18H19ClN2 — CID 974585
1-[(3-chlorophenyl)methyl]-2-(2-methylpropyl)benzimidazole (PubChem CID 974585) has the molecular formula C18H19ClN2 and a molecular weight of 298.82 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2-(2-methylpropyl)benzimidazole.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2-(2-methylpropyl)benzimidazole |
|---|---|
| PubChem CID | 974585 |
| Molecular Formula | C18H19ClN2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2-(2-methylpropyl)benzimidazole |
| SMILES | CC(C)Cc1nc2ccccc2n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19ClN2/c1-13(2)10-18-20-16-8-3-4-9-17(16)21(18)12-14-6-5-7-15(19)11-14/h3-9,11,13H,10,12H2,1-2H3 |
| InChIKey | NASVFYZJIYSVOA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |