C16H24N4O2S — CID 97458521
[(2R,3aS,6aS)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 97458521) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is [(2R,3aS,6aS)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(2R,3aS,6aS)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 97458521 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(2R,3aS,6aS)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)[C@H]2C[C@H]3[C@H](CCN3Cc3nccs3)O2)CC1 |
| InChI | InChI=1S/C16H24N4O2S/c1-18-5-7-19(8-6-18)16(21)14-10-12-13(22-14)2-4-20(12)11-15-17-3-9-23-15/h3,9,12-14H,2,4-8,10-11H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | FAUGIXWKGCQKJF-MELADBBJSA-N |
| XLogP | 0.65 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |