C16H23N3 — CID 97458960
(3aR,6aS)-1-(cyclopropylmethyl)-4-(pyridin-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 97458960) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is (3aR,6aS)-1-(cyclopropylmethyl)-4-(pyridin-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aR,6aS)-1-(cyclopropylmethyl)-4-(pyridin-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97458960 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (3aR,6aS)-1-(cyclopropylmethyl)-4-(pyridin-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | c1cc(CN2CC[C@H]3[C@H]2CCN3CC2CC2)ccn1 |
| InChI | InChI=1S/C16H23N3/c1-2-13(1)11-18-9-5-16-15(18)6-10-19(16)12-14-3-7-17-8-4-14/h3-4,7-8,13,15-16H,1-2,5-6,9-12H2/t15-,16+/m0/s1 |
| InChIKey | NLTQSRQDROGRTN-JKSUJKDBSA-N |
| XLogP | 2.14 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |