C17H24N2O2S — CID 97459079
(3aS,6aR)-4-cyclopropylsulfonyl-1-[(4-methylphenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 97459079) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is (3aS,6aR)-4-cyclopropylsulfonyl-1-[(4-methylphenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aS,6aR)-4-cyclopropylsulfonyl-1-[(4-methylphenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97459079 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (3aS,6aR)-4-cyclopropylsulfonyl-1-[(4-methylphenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | Cc1ccc(CN2CC[C@H]3[C@H]2CCN3S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C17H24N2O2S/c1-13-2-4-14(5-3-13)12-18-10-8-17-16(18)9-11-19(17)22(20,21)15-6-7-15/h2-5,15-17H,6-12H2,1H3/t16-,17+/m1/s1 |
| InChIKey | XOFVQIAHDCBSQP-SJORKVTESA-N |
| XLogP | 2.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |