C14H21N5O — CID 97459396
(3aR,6aS)-N-propan-2-yl-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide (PubChem CID 97459396) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is (3aR,6aS)-N-propan-2-yl-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide.
| Compound Name | (3aR,6aS)-N-propan-2-yl-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 97459396 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (3aR,6aS)-N-propan-2-yl-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
| SMILES | CC(C)NC(=O)N1CC[C@H]2[C@H]1CCN2c1ncccn1 |
| InChI | InChI=1S/C14H21N5O/c1-10(2)17-14(20)19-9-5-11-12(19)4-8-18(11)13-15-6-3-7-16-13/h3,6-7,10-12H,4-5,8-9H2,1-2H3,(H,17,20)/t11-,12+/m0/s1 |
| InChIKey | HNAPIEBXGRCKRL-NWDGAFQWSA-N |
| XLogP | 1.25 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |