C13H18N2O2S — CID 97459527
(3R,3aR,6aS)-3-prop-2-enoxy-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole (PubChem CID 97459527) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is (3R,3aR,6aS)-3-prop-2-enoxy-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | (3R,3aR,6aS)-3-prop-2-enoxy-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 97459527 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3R,3aR,6aS)-3-prop-2-enoxy-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
| SMILES | C=CCO[C@H]1CN(Cc2nccs2)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C13H18N2O2S/c1-2-4-17-12-6-15(7-13-14-3-5-18-13)11-9-16-8-10(11)12/h2-3,5,10-12H,1,4,6-9H2/t10-,11+,12-/m0/s1 |
| InChIKey | PEIWVNMKZPKIBZ-TUAOUCFPSA-N |
| XLogP | 1.54 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|