C17H21N3O3S — CID 97459610
[(3R,3aR,6aS)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1-methylpyrrol-2-yl)methanone (PubChem CID 97459610) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(3R,3aR,6aS)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1-methylpyrrol-2-yl)methanone.
| Compound Name | [(3R,3aR,6aS)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1-methylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 97459610 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(3R,3aR,6aS)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1-methylpyrrol-2-yl)methanone |
| SMILES | Cc1nc(CO[C@H]2CN(C(=O)c3cccn3C)[C@@H]3COC[C@H]23)cs1 |
| InChI | InChI=1S/C17H21N3O3S/c1-11-18-12(10-24-11)7-23-16-6-20(15-9-22-8-13(15)16)17(21)14-4-3-5-19(14)2/h3-5,10,13,15-16H,6-9H2,1-2H3/t13-,15+,16-/m0/s1 |
| InChIKey | OMCRKKBWDPSDSA-IMJJTQAJSA-N |
| XLogP | 1.85 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |