C14H22N2O3S — CID 97459617
(3R,3aR,6aS)-1-(2-methoxyethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole (PubChem CID 97459617) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is (3R,3aR,6aS)-1-(2-methoxyethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | (3R,3aR,6aS)-1-(2-methoxyethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 97459617 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (3R,3aR,6aS)-1-(2-methoxyethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
| SMILES | COCCN1C[C@H](OCc2csc(C)n2)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C14H22N2O3S/c1-10-15-11(9-20-10)6-19-14-5-16(3-4-17-2)13-8-18-7-12(13)14/h9,12-14H,3-8H2,1-2H3/t12-,13+,14-/m0/s1 |
| InChIKey | HEMIFUYJRYHKLZ-MJBXVCDLSA-N |
| XLogP | 1.31 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |