C16H23N3O2 — CID 97459656
N-[(3S,3aR,6aS)-1-(cyclopropylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 97459656) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[(3S,3aR,6aS)-1-(cyclopropylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[(3S,3aR,6aS)-1-(cyclopropylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97459656 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[(3S,3aR,6aS)-1-(cyclopropylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)N[C@@H]1CN(CC2CC2)[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C16H23N3O2/c1-18-6-2-3-14(18)16(20)17-13-8-19(7-11-4-5-11)15-10-21-9-12(13)15/h2-3,6,11-13,15H,4-5,7-10H2,1H3,(H,17,20)/t12-,13-,15-/m1/s1 |
| InChIKey | ZZUIQPAGFCXFFC-UMVBOHGHSA-N |
| XLogP | 0.86 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |