C18H22N4O3 — CID 97459906
[(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(5-methylfuran-2-yl)methanone (PubChem CID 97459906) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is [(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(5-methylfuran-2-yl)methanone.
| Compound Name | [(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(5-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 97459906 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(5-methylfuran-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CC[C@@H]3[C@@H](CO[C@H]3CNc3ncccn3)C2)o1 |
| InChI | InChI=1S/C18H22N4O3/c1-12-3-4-15(25-12)17(23)22-8-5-14-13(10-22)11-24-16(14)9-21-18-19-6-2-7-20-18/h2-4,6-7,13-14,16H,5,8-11H2,1H3,(H,19,20,21)/t13-,14-,16+/m1/s1 |
| InChIKey | LGIKBLTZIAGHBK-FMKPAKJESA-N |
| XLogP | 1.97 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |