C19H29N3O2 — CID 97459960
3-[[(3S,3aR,7aR)-5-[(3-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1,1-dimethylurea (PubChem CID 97459960) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-[[(3S,3aR,7aR)-5-[(3-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[(3S,3aR,7aR)-5-[(3-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 97459960 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 3-[[(3S,3aR,7aR)-5-[(3-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1,1-dimethylurea |
| SMILES | Cc1cccc(CN2CC[C@H]3CO[C@H](CNC(=O)N(C)C)[C@H]3C2)c1 |
| InChI | InChI=1S/C19H29N3O2/c1-14-5-4-6-15(9-14)11-22-8-7-16-13-24-18(17(16)12-22)10-20-19(23)21(2)3/h4-6,9,16-18H,7-8,10-13H2,1-3H3,(H,20,23)/t16-,17-,18+/m0/s1 |
| InChIKey | WPEIESAPDAIJKK-OKZBNKHCSA-N |
| XLogP | 2.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |