C16H23FN2O3S — CID 97459979
N-[[(3S,3aR,7aR)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide (PubChem CID 97459979) has the molecular formula C16H23FN2O3S and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[[(3S,3aR,7aR)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S,3aR,7aR)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 97459979 |
| Molecular Formula | C16H23FN2O3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[[(3S,3aR,7aR)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H]1OC[C@@H]2CCN(Cc3cccc(F)c3)C[C@@H]21 |
| InChI | InChI=1S/C16H23FN2O3S/c1-23(20,21)18-8-16-15-10-19(6-5-13(15)11-22-16)9-12-3-2-4-14(17)7-12/h2-4,7,13,15-16,18H,5-6,8-11H2,1H3/t13-,15-,16+/m0/s1 |
| InChIKey | NMPPQATYCXESIX-CWRNSKLLSA-N |
| XLogP | 1.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |