C17H28FN5 — CID 97460080
1-[(2S,3aR,7aS)-5-(5-fluoropyrimidin-2-yl)-1-propan-2-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]-N,N-dimethylmethanamine (PubChem CID 97460080) has the molecular formula C17H28FN5 and a molecular weight of 321.44 g/mol. Its IUPAC name is 1-[(2S,3aR,7aS)-5-(5-fluoropyrimidin-2-yl)-1-propan-2-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(2S,3aR,7aS)-5-(5-fluoropyrimidin-2-yl)-1-propan-2-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 97460080 |
| Molecular Formula | C17H28FN5 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-[(2S,3aR,7aS)-5-(5-fluoropyrimidin-2-yl)-1-propan-2-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]-N,N-dimethylmethanamine |
| SMILES | CC(C)N1[C@H](CN(C)C)C[C@@H]2CN(c3ncc(F)cn3)CC[C@@H]21 |
| InChI | InChI=1S/C17H28FN5/c1-12(2)23-15(11-21(3)4)7-13-10-22(6-5-16(13)23)17-19-8-14(18)9-20-17/h8-9,12-13,15-16H,5-7,10-11H2,1-4H3/t13-,15+,16+/m1/s1 |
| InChIKey | ZIUCWUMGYMFSGV-KBMXLJTQSA-N |
| XLogP | 1.85 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |